C34H38N6O4Si — CID 57054388
N-[9-[(2R,5R)-5-(aminomethyl)-4-[tert-butyl(diphenyl)silyl]oxy-3-methoxyoxolan-2-yl]purin-6-yl]benzamide (PubChem CID 57054388) has the molecular formula C34H38N6O4Si and a molecular weight of 622.80 g/mol. Its IUPAC name is N-[9-[(2R,5R)-5-(aminomethyl)-4-[tert-butyl(diphenyl)silyl]oxy-3-methoxyoxolan-2-yl]purin-6-yl]benzamide.
| Compound Name | N-[9-[(2R,5R)-5-(aminomethyl)-4-[tert-butyl(diphenyl)silyl]oxy-3-methoxyoxolan-2-yl]purin-6-yl]benzamide |
|---|---|
| PubChem CID | 57054388 |
| Molecular Formula | C34H38N6O4Si |
| Molecular Weight | 622.80 g/mol |
| Exact Mass | 622.27 |
| IUPAC Name | N-[9-[(2R,5R)-5-(aminomethyl)-4-[tert-butyl(diphenyl)silyl]oxy-3-methoxyoxolan-2-yl]purin-6-yl]benzamide |
| SMILES | COC1C(O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@@H](CN)O[C@H]1n1cnc2c(NC(=O)c3ccccc3)ncnc21 |
| InChI | InChI=1S/C34H38N6O4Si/c1-34(2,3)45(24-16-10-6-11-17-24,25-18-12-7-13-19-25)44-28-26(20-35)43-33(29(28)42-4)40-22-38-27-30(36-21-37-31(27)40)39-32(41)23-14-8-5-9-15-23/h5-19,21-22,26,28-29,33H,20,35H2,1-4H3,(H,36,37,39,41)/t26-,28?,29?,33-/m1/s1 |
| InChIKey | FBEMXGLEJJXPFV-UNIRPQOHSA-N |
| XLogP | 3.89 |
| TPSA | 126.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.80 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|