C26H37N5O6Si — CID 177314930
N-[9-[(2R,3R,4R,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-hydroxy-3-(2-methoxyethoxy)oxolan-2-yl]purin-6-yl]benzamide (PubChem CID 177314930) has the molecular formula C26H37N5O6Si and a molecular weight of 543.70 g/mol. Its IUPAC name is N-[9-[(2R,3R,4R,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-hydroxy-3-(2-methoxyethoxy)oxolan-2-yl]purin-6-yl]benzamide.
| Compound Name | N-[9-[(2R,3R,4R,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-hydroxy-3-(2-methoxyethoxy)oxolan-2-yl]purin-6-yl]benzamide |
|---|---|
| PubChem CID | 177314930 |
| Molecular Formula | C26H37N5O6Si |
| Molecular Weight | 543.70 g/mol |
| Exact Mass | 543.25 |
| IUPAC Name | N-[9-[(2R,3R,4R,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-hydroxy-3-(2-methoxyethoxy)oxolan-2-yl]purin-6-yl]benzamide |
| SMILES | COCCO[C@@H]1[C@H](O)[C@@H](CO[Si](C)(C)C(C)(C)C)O[C@H]1n1cnc2c(NC(=O)c3ccccc3)ncnc21 |
| InChI | InChI=1S/C26H37N5O6Si/c1-26(2,3)38(5,6)36-14-18-20(32)21(35-13-12-34-4)25(37-18)31-16-29-19-22(27-15-28-23(19)31)30-24(33)17-10-8-7-9-11-17/h7-11,15-16,18,20-21,25,32H,12-14H2,1-6H3,(H,27,28,30,33)/t18-,20-,21-,25-/m1/s1 |
| InChIKey | GJFLMABSLXOIEM-GUQHISFFSA-N |
| XLogP | 3.39 |
| TPSA | 129.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.70 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|