C29H44N6O7Si2 — CID 174107022
[5-(6-benzamidopurin-9-yl)-4-[tert-butyl(dimethyl)silyl]oxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-3-yl] nitrate (PubChem CID 174107022) has the molecular formula C29H44N6O7Si2 and a molecular weight of 644.88 g/mol. Its IUPAC name is [5-(6-benzamidopurin-9-yl)-4-[tert-butyl(dimethyl)silyl]oxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-3-yl] nitrate.
| Compound Name | [5-(6-benzamidopurin-9-yl)-4-[tert-butyl(dimethyl)silyl]oxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-3-yl] nitrate |
|---|---|
| PubChem CID | 174107022 |
| Molecular Formula | C29H44N6O7Si2 |
| Molecular Weight | 644.88 g/mol |
| Exact Mass | 644.28 |
| IUPAC Name | [5-(6-benzamidopurin-9-yl)-4-[tert-butyl(dimethyl)silyl]oxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-3-yl] nitrate |
| SMILES | CC(C)(C)[Si](C)(C)OCC1OC(n2cnc3c(NC(=O)c4ccccc4)ncnc32)C(O[Si](C)(C)C(C)(C)C)C1O[N+](=O)[O-] |
| InChI | InChI=1S/C29H44N6O7Si2/c1-28(2,3)43(7,8)39-16-20-22(41-35(37)38)23(42-44(9,10)29(4,5)6)27(40-20)34-18-32-21-24(30-17-31-25(21)34)33-26(36)19-14-12-11-13-15-19/h11-15,17-18,20,22-23,27H,16H2,1-10H3,(H,30,31,33,36) |
| InChIKey | XYHKJLHCHCPQJZ-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 152.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.88 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|