C24H31N5O5Si — CID 14192254
methyl (2R,3R,4S)-2-(6-benzamidopurin-9-yl)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]oxetane-3-carboxylate (PubChem CID 14192254) has the molecular formula C24H31N5O5Si and a molecular weight of 497.63 g/mol. Its IUPAC name is methyl (2R,3R,4S)-2-(6-benzamidopurin-9-yl)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]oxetane-3-carboxylate.
| Compound Name | methyl (2R,3R,4S)-2-(6-benzamidopurin-9-yl)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]oxetane-3-carboxylate |
|---|---|
| PubChem CID | 14192254 |
| Molecular Formula | C24H31N5O5Si |
| Molecular Weight | 497.63 g/mol |
| Exact Mass | 497.21 |
| IUPAC Name | methyl (2R,3R,4S)-2-(6-benzamidopurin-9-yl)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]oxetane-3-carboxylate |
| SMILES | COC(=O)[C@H]1[C@H](n2cnc3c(NC(=O)c4ccccc4)ncnc32)O[C@@H]1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H31N5O5Si/c1-24(2,3)35(5,6)33-12-16-17(23(31)32-4)22(34-16)29-14-27-18-19(25-13-26-20(18)29)28-21(30)15-10-8-7-9-11-15/h7-11,13-14,16-17,22H,12H2,1-6H3,(H,25,26,28,30)/t16-,17-,22-/m1/s1 |
| InChIKey | ZOQHPNDZZHEETB-DRSNIGMVSA-N |
| XLogP | 3.79 |
| TPSA | 117.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.63 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|