C24H34N6O3Si — CID 174151359
N-[9-[(2R,3S,5R)-4-amino-3-[tert-butyl(dimethyl)silyl]oxy-5-ethyloxolan-2-yl]purin-6-yl]benzamide (PubChem CID 174151359) has the molecular formula C24H34N6O3Si and a molecular weight of 482.66 g/mol. Its IUPAC name is N-[9-[(2R,3S,5R)-4-amino-3-[tert-butyl(dimethyl)silyl]oxy-5-ethyloxolan-2-yl]purin-6-yl]benzamide.
| Compound Name | N-[9-[(2R,3S,5R)-4-amino-3-[tert-butyl(dimethyl)silyl]oxy-5-ethyloxolan-2-yl]purin-6-yl]benzamide |
|---|---|
| PubChem CID | 174151359 |
| Molecular Formula | C24H34N6O3Si |
| Molecular Weight | 482.66 g/mol |
| Exact Mass | 482.25 |
| IUPAC Name | N-[9-[(2R,3S,5R)-4-amino-3-[tert-butyl(dimethyl)silyl]oxy-5-ethyloxolan-2-yl]purin-6-yl]benzamide |
| SMILES | CC[C@H]1O[C@@H](n2cnc3c(NC(=O)c4ccccc4)ncnc32)[C@@H](O[Si](C)(C)C(C)(C)C)C1N |
| InChI | InChI=1S/C24H34N6O3Si/c1-7-16-17(25)19(33-34(5,6)24(2,3)4)23(32-16)30-14-28-18-20(26-13-27-21(18)30)29-22(31)15-11-9-8-10-12-15/h8-14,16-17,19,23H,7,25H2,1-6H3,(H,26,27,29,31)/t16-,17?,19+,23-/m1/s1 |
| InChIKey | IJYYVFHFFRCWBM-XASWECBHSA-N |
| XLogP | 4.10 |
| TPSA | 117.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.66 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|