C32H39N5O4Si — CID 174151397
N-benzoyl-N-[9-[(2R,3S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-ethyl-4-methyloxolan-2-yl]purin-6-yl]benzamide (PubChem CID 174151397) has the molecular formula C32H39N5O4Si and a molecular weight of 585.78 g/mol. Its IUPAC name is N-benzoyl-N-[9-[(2R,3S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-ethyl-4-methyloxolan-2-yl]purin-6-yl]benzamide.
| Compound Name | N-benzoyl-N-[9-[(2R,3S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-ethyl-4-methyloxolan-2-yl]purin-6-yl]benzamide |
|---|---|
| PubChem CID | 174151397 |
| Molecular Formula | C32H39N5O4Si |
| Molecular Weight | 585.78 g/mol |
| Exact Mass | 585.28 |
| IUPAC Name | N-benzoyl-N-[9-[(2R,3S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-ethyl-4-methyloxolan-2-yl]purin-6-yl]benzamide |
| SMILES | CC[C@H]1O[C@@H](n2cnc3c(N(C(=O)c4ccccc4)C(=O)c4ccccc4)ncnc32)[C@@H](O[Si](C)(C)C(C)(C)C)C1C |
| InChI | InChI=1S/C32H39N5O4Si/c1-8-24-21(2)26(41-42(6,7)32(3,4)5)31(40-24)36-20-35-25-27(36)33-19-34-28(25)37(29(38)22-15-11-9-12-16-22)30(39)23-17-13-10-14-18-23/h9-21,24,26,31H,8H2,1-7H3/t21?,24-,26+,31-/m1/s1 |
| InChIKey | NFLCSEMLRFWGHC-UNZKMCDVSA-N |
| XLogP | 6.65 |
| TPSA | 99.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.78 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|