C40H33N5O7S2 — CID 23253575
[(2S,3S,4R,5R)-4-benzoyloxy-2-[bis(methylsulfanyl)methyl]-5-[6-(dibenzoylamino)purin-9-yl]oxolan-3-yl] benzoate (PubChem CID 23253575) has the molecular formula C40H33N5O7S2 and a molecular weight of 759.87 g/mol. Its IUPAC name is [(2S,3S,4R,5R)-4-benzoyloxy-2-[bis(methylsulfanyl)methyl]-5-[6-(dibenzoylamino)purin-9-yl]oxolan-3-yl] benzoate.
| Compound Name | [(2S,3S,4R,5R)-4-benzoyloxy-2-[bis(methylsulfanyl)methyl]-5-[6-(dibenzoylamino)purin-9-yl]oxolan-3-yl] benzoate |
|---|---|
| PubChem CID | 23253575 |
| Molecular Formula | C40H33N5O7S2 |
| Molecular Weight | 759.87 g/mol |
| Exact Mass | 759.18 |
| IUPAC Name | [(2S,3S,4R,5R)-4-benzoyloxy-2-[bis(methylsulfanyl)methyl]-5-[6-(dibenzoylamino)purin-9-yl]oxolan-3-yl] benzoate |
| SMILES | CSC(SC)[C@H]1O[C@@H](n2cnc3c(N(C(=O)c4ccccc4)C(=O)c4ccccc4)ncnc32)[C@H](OC(=O)c2ccccc2)[C@@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C40H33N5O7S2/c1-53-40(54-2)32-30(51-38(48)27-19-11-5-12-20-27)31(52-39(49)28-21-13-6-14-22-28)37(50-32)44-24-43-29-33(44)41-23-42-34(29)45(35(46)25-15-7-3-8-16-25)36(47)26-17-9-4-10-18-26/h3-24,30-32,37,40H,1-2H3/t30-,31+,32-,37+/m0/s1 |
| InChIKey | COGWAWGRMFRIKE-AWYYSMRRSA-N |
| XLogP | 6.71 |
| TPSA | 142.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 759.87 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|