C52H42FN5O8 — CID 146403433
[(2R,3R,4S,5R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-[6-(dibenzoylamino)purin-9-yl]-4-fluorooxolan-3-yl] benzoate (PubChem CID 146403433) has the molecular formula C52H42FN5O8 and a molecular weight of 883.93 g/mol. Its IUPAC name is [(2R,3R,4S,5R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-[6-(dibenzoylamino)purin-9-yl]-4-fluorooxolan-3-yl] benzoate.
| Compound Name | [(2R,3R,4S,5R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-[6-(dibenzoylamino)purin-9-yl]-4-fluorooxolan-3-yl] benzoate |
|---|---|
| PubChem CID | 146403433 |
| Molecular Formula | C52H42FN5O8 |
| Molecular Weight | 883.93 g/mol |
| Exact Mass | 883.30 |
| IUPAC Name | [(2R,3R,4S,5R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-[6-(dibenzoylamino)purin-9-yl]-4-fluorooxolan-3-yl] benzoate |
| SMILES | COc1ccc(C(OC[C@H]2O[C@@H](n3cnc4c(N(C(=O)c5ccccc5)C(=O)c5ccccc5)ncnc43)[C@@H](F)[C@@H]2OC(=O)c2ccccc2)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C52H42FN5O8/c1-62-40-27-23-38(24-28-40)52(37-21-13-6-14-22-37,39-25-29-41(63-2)30-26-39)64-31-42-45(66-51(61)36-19-11-5-12-20-36)43(53)50(65-42)57-33-56-44-46(57)54-32-55-47(44)58(48(59)34-15-7-3-8-16-34)49(60)35-17-9-4-10-18-35/h3-30,32-33,42-43,45,50H,31H2,1-2H3/t42-,43+,45-,50-/m1/s1 |
| InChIKey | RGHCLZYEACMXOY-AUMPYMIOSA-N |
| XLogP | 8.80 |
| TPSA | 144.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 66 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 883.93 |
| LogP ≤ 5 | 8.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|