C43H41FN5O9- — CID 172642358
4-[(2R,3S,5R)-5-(6-benzamidopurin-9-yl)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-fluorooxolan-3-yl]oxy-4-oxobutanoate;methane (PubChem CID 172642358) has the molecular formula C43H41FN5O9- and a molecular weight of 790.83 g/mol. Its IUPAC name is 4-[(2R,3S,5R)-5-(6-benzamidopurin-9-yl)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-fluorooxolan-3-yl]oxy-4-oxobutanoate;methane.
| Compound Name | 4-[(2R,3S,5R)-5-(6-benzamidopurin-9-yl)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-fluorooxolan-3-yl]oxy-4-oxobutanoate;methane |
|---|---|
| PubChem CID | 172642358 |
| Molecular Formula | C43H41FN5O9- |
| Molecular Weight | 790.83 g/mol |
| Exact Mass | 790.29 |
| IUPAC Name | 4-[(2R,3S,5R)-5-(6-benzamidopurin-9-yl)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-fluorooxolan-3-yl]oxy-4-oxobutanoate;methane |
| SMILES | C.COc1ccc(C(OC[C@H]2O[C@@H](n3cnc4c(NC(=O)c5ccccc5)ncnc43)C(F)[C@H]2OC(=O)CCC(=O)[O-])(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C42H38FN5O9.CH4/c1-53-30-17-13-28(14-18-30)42(27-11-7-4-8-12-27,29-15-19-31(54-2)20-16-29)55-23-32-37(57-34(51)22-21-33(49)50)35(43)41(56-32)48-25-46-36-38(44-24-45-39(36)48)47-40(52)26-9-5-3-6-10-26;/h3-20,24-25,32,35,37,41H,21-23H2,1-2H3,(H,49,50)(H,44,45,47,52);1H4/p-1/t32-,35?,37+,41-;/m1./s1 |
| InChIKey | VHUHMVYEAARMHV-YHCFPLHYSA-M |
| XLogP | 5.42 |
| TPSA | 176.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 790.83 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|