C37H32IN5O5 — CID 14805360
N-[9-[(2R,3S,4R,5R)-3-hydroxy-4-iodo-5-[[(4-methoxyphenyl)-diphenylmethoxy]methyl]oxolan-2-yl]purin-6-yl]benzamide (PubChem CID 14805360) has the molecular formula C37H32IN5O5 and a molecular weight of 753.60 g/mol. Its IUPAC name is N-[9-[(2R,3S,4R,5R)-3-hydroxy-4-iodo-5-[[(4-methoxyphenyl)-diphenylmethoxy]methyl]oxolan-2-yl]purin-6-yl]benzamide.
| Compound Name | N-[9-[(2R,3S,4R,5R)-3-hydroxy-4-iodo-5-[[(4-methoxyphenyl)-diphenylmethoxy]methyl]oxolan-2-yl]purin-6-yl]benzamide |
|---|---|
| PubChem CID | 14805360 |
| Molecular Formula | C37H32IN5O5 |
| Molecular Weight | 753.60 g/mol |
| Exact Mass | 753.14 |
| IUPAC Name | N-[9-[(2R,3S,4R,5R)-3-hydroxy-4-iodo-5-[[(4-methoxyphenyl)-diphenylmethoxy]methyl]oxolan-2-yl]purin-6-yl]benzamide |
| SMILES | COc1ccc(C(OC[C@H]2O[C@@H](n3cnc4c(NC(=O)c5ccccc5)ncnc43)[C@H](O)[C@H]2I)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C37H32IN5O5/c1-46-28-19-17-27(18-20-28)37(25-13-7-3-8-14-25,26-15-9-4-10-16-26)47-21-29-30(38)32(44)36(48-29)43-23-41-31-33(39-22-40-34(31)43)42-35(45)24-11-5-2-6-12-24/h2-20,22-23,29-30,32,36,44H,21H2,1H3,(H,39,40,42,45)/t29-,30+,32-,36-/m1/s1 |
| InChIKey | KTPVEVDFWMLXDI-HZODXTMNSA-N |
| XLogP | 6.16 |
| TPSA | 120.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 753.60 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|