C45H40N6O8 — CID 66842606
[(2R,3R,4R,5R)-2-(6-benzamidopurin-9-yl)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxyoxolan-3-yl] N-phenylcarbamate (PubChem CID 66842606) has the molecular formula C45H40N6O8 and a molecular weight of 792.85 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-2-(6-benzamidopurin-9-yl)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxyoxolan-3-yl] N-phenylcarbamate.
| Compound Name | [(2R,3R,4R,5R)-2-(6-benzamidopurin-9-yl)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxyoxolan-3-yl] N-phenylcarbamate |
|---|---|
| PubChem CID | 66842606 |
| Molecular Formula | C45H40N6O8 |
| Molecular Weight | 792.85 g/mol |
| Exact Mass | 792.29 |
| IUPAC Name | [(2R,3R,4R,5R)-2-(6-benzamidopurin-9-yl)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxyoxolan-3-yl] N-phenylcarbamate |
| SMILES | COc1ccc(C(OC[C@H]2O[C@@H](n3cnc4c(NC(=O)c5ccccc5)ncnc43)[C@H](OC(=O)Nc3ccccc3)[C@@H]2O)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C45H40N6O8/c1-55-34-22-18-31(19-23-34)45(30-14-8-4-9-15-30,32-20-24-35(56-2)25-21-32)57-26-36-38(52)39(59-44(54)49-33-16-10-5-11-17-33)43(58-36)51-28-48-37-40(46-27-47-41(37)51)50-42(53)29-12-6-3-7-13-29/h3-25,27-28,36,38-39,43,52H,26H2,1-2H3,(H,49,54)(H,46,47,50,53)/t36-,38-,39-,43-/m1/s1 |
| InChIKey | ZGXJELSOKWOWEY-WGHXVSNRSA-N |
| XLogP | 6.98 |
| TPSA | 168.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 59 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 792.85 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|