C37H40N6O8 — CID 70994804
3-[(2R,5R)-2-(6-acetamidopurin-9-yl)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxyoxolan-3-yl]oxy-N-methylpropanamide (PubChem CID 70994804) has the molecular formula C37H40N6O8 and a molecular weight of 696.76 g/mol. Its IUPAC name is 3-[(2R,5R)-2-(6-acetamidopurin-9-yl)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxyoxolan-3-yl]oxy-N-methylpropanamide.
| Compound Name | 3-[(2R,5R)-2-(6-acetamidopurin-9-yl)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxyoxolan-3-yl]oxy-N-methylpropanamide |
|---|---|
| PubChem CID | 70994804 |
| Molecular Formula | C37H40N6O8 |
| Molecular Weight | 696.76 g/mol |
| Exact Mass | 696.29 |
| IUPAC Name | 3-[(2R,5R)-2-(6-acetamidopurin-9-yl)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxyoxolan-3-yl]oxy-N-methylpropanamide |
| SMILES | CNC(=O)CCOC1C(O)[C@@H](COC(c2ccccc2)(c2ccc(OC)cc2)c2ccc(OC)cc2)O[C@H]1n1cnc2c(NC(C)=O)ncnc21 |
| InChI | InChI=1S/C37H40N6O8/c1-23(44)42-34-31-35(40-21-39-34)43(22-41-31)36-33(49-19-18-30(45)38-2)32(46)29(51-36)20-50-37(24-8-6-5-7-9-24,25-10-14-27(47-3)15-11-25)26-12-16-28(48-4)17-13-26/h5-17,21-22,29,32-33,36,46H,18-20H2,1-4H3,(H,38,45)(H,39,40,42,44)/t29-,32?,33?,36-/m1/s1 |
| InChIKey | CMWTVNKCLYMSOX-KJFLEFOQSA-N |
| XLogP | 3.59 |
| TPSA | 168.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.76 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|