C57H49N5O6 — CID 10463457
N-[9-[(2R,3R,4S)-3,4-bis[[(4-methoxyphenyl)-diphenylmethoxy]methyl]oxetan-2-yl]purin-6-yl]benzamide (PubChem CID 10463457) has the molecular formula C57H49N5O6 and a molecular weight of 900.05 g/mol. Its IUPAC name is N-[9-[(2R,3R,4S)-3,4-bis[[(4-methoxyphenyl)-diphenylmethoxy]methyl]oxetan-2-yl]purin-6-yl]benzamide.
| Compound Name | N-[9-[(2R,3R,4S)-3,4-bis[[(4-methoxyphenyl)-diphenylmethoxy]methyl]oxetan-2-yl]purin-6-yl]benzamide |
|---|---|
| PubChem CID | 10463457 |
| Molecular Formula | C57H49N5O6 |
| Molecular Weight | 900.05 g/mol |
| Exact Mass | 899.37 |
| IUPAC Name | N-[9-[(2R,3R,4S)-3,4-bis[[(4-methoxyphenyl)-diphenylmethoxy]methyl]oxetan-2-yl]purin-6-yl]benzamide |
| SMILES | COc1ccc(C(OC[C@H]2[C@H](n3cnc4c(NC(=O)c5ccccc5)ncnc43)O[C@@H]2COC(c2ccccc2)(c2ccccc2)c2ccc(OC)cc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C57H49N5O6/c1-64-47-32-28-45(29-33-47)56(41-20-10-4-11-21-41,42-22-12-5-13-23-42)66-36-49-50(68-55(49)62-39-60-51-52(58-38-59-53(51)62)61-54(63)40-18-8-3-9-19-40)37-67-57(43-24-14-6-15-25-43,44-26-16-7-17-27-44)46-30-34-48(65-2)35-31-46/h3-35,38-39,49-50,55H,36-37H2,1-2H3,(H,58,59,61,63)/t49-,50-,55-/m1/s1 |
| InChIKey | UIRKVYKMIABTPC-ATGIGKTLSA-N |
| XLogP | 10.63 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 900.05 |
| LogP ≤ 5 | 10.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|