C44H50N5O9PSi — CID 174995481
[(2R,3R,4R,5R)-5-(6-benzamidopurin-9-yl)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-[tert-butyl(dimethyl)silyl]oxyoxolan-3-yl]phosphonic acid (PubChem CID 174995481) has the molecular formula C44H50N5O9PSi and a molecular weight of 851.97 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-5-(6-benzamidopurin-9-yl)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-[tert-butyl(dimethyl)silyl]oxyoxolan-3-yl]phosphonic acid.
| Compound Name | [(2R,3R,4R,5R)-5-(6-benzamidopurin-9-yl)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-[tert-butyl(dimethyl)silyl]oxyoxolan-3-yl]phosphonic acid |
|---|---|
| PubChem CID | 174995481 |
| Molecular Formula | C44H50N5O9PSi |
| Molecular Weight | 851.97 g/mol |
| Exact Mass | 851.31 |
| IUPAC Name | [(2R,3R,4R,5R)-5-(6-benzamidopurin-9-yl)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-[tert-butyl(dimethyl)silyl]oxyoxolan-3-yl]phosphonic acid |
| SMILES | COc1ccc(C(OC[C@H]2O[C@@H](n3cnc4c(NC(=O)c5ccccc5)ncnc43)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]2P(=O)(O)O)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C44H50N5O9PSi/c1-43(2,3)60(6,7)58-37-38(59(51,52)53)35(57-42(37)49-28-47-36-39(45-27-46-40(36)49)48-41(50)29-14-10-8-11-15-29)26-56-44(30-16-12-9-13-17-30,31-18-22-33(54-4)23-19-31)32-20-24-34(55-5)25-21-32/h8-25,27-28,35,37-38,42H,26H2,1-7H3,(H2,51,52,53)(H,45,46,48,50)/t35-,37+,38-,42-/m1/s1 |
| InChIKey | VRMOVVVTSJWTIO-OYQUPYODSA-N |
| XLogP | 7.94 |
| TPSA | 176.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 851.97 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|