C45H51N5O8Si — CID 10930846
N-[9-[(2R,3R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-[tert-butyl(dimethyl)silyl]oxy-3-hydroxyoxolan-2-yl]purin-6-yl]-2-phenoxyacetamide (PubChem CID 10930846) has the molecular formula C45H51N5O8Si and a molecular weight of 818.02 g/mol. Its IUPAC name is N-[9-[(2R,3R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-[tert-butyl(dimethyl)silyl]oxy-3-hydroxyoxolan-2-yl]purin-6-yl]-2-phenoxyacetamide.
| Compound Name | N-[9-[(2R,3R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-[tert-butyl(dimethyl)silyl]oxy-3-hydroxyoxolan-2-yl]purin-6-yl]-2-phenoxyacetamide |
|---|---|
| PubChem CID | 10930846 |
| Molecular Formula | C45H51N5O8Si |
| Molecular Weight | 818.02 g/mol |
| Exact Mass | 817.35 |
| IUPAC Name | N-[9-[(2R,3R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-[tert-butyl(dimethyl)silyl]oxy-3-hydroxyoxolan-2-yl]purin-6-yl]-2-phenoxyacetamide |
| SMILES | COc1ccc(C(OC[C@H]2O[C@@H](n3cnc4c(NC(=O)COc5ccccc5)ncnc43)[C@H](O)[C@@H]2O[Si](C)(C)C(C)(C)C)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C45H51N5O8Si/c1-44(2,3)59(6,7)58-40-36(26-56-45(30-14-10-8-11-15-30,31-18-22-33(53-4)23-19-31)32-20-24-34(54-5)25-21-32)57-43(39(40)52)50-29-48-38-41(46-28-47-42(38)50)49-37(51)27-55-35-16-12-9-13-17-35/h8-25,28-29,36,39-40,43,52H,26-27H2,1-7H3,(H,46,47,49,51)/t36-,39-,40-,43-/m1/s1 |
| InChIKey | CLZUANLZHUFFBR-DQZBACKDSA-N |
| XLogP | 7.52 |
| TPSA | 148.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 59 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 818.02 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|