C42H40N6O8 — CID 101439016
N-[9-[(2R,3R,4R,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3-(2-cyanoethoxy)-4-hydroxyoxolan-2-yl]purin-6-yl]-2-phenoxyacetamide (PubChem CID 101439016) has the molecular formula C42H40N6O8 and a molecular weight of 756.82 g/mol. Its IUPAC name is N-[9-[(2R,3R,4R,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3-(2-cyanoethoxy)-4-hydroxyoxolan-2-yl]purin-6-yl]-2-phenoxyacetamide.
| Compound Name | N-[9-[(2R,3R,4R,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3-(2-cyanoethoxy)-4-hydroxyoxolan-2-yl]purin-6-yl]-2-phenoxyacetamide |
|---|---|
| PubChem CID | 101439016 |
| Molecular Formula | C42H40N6O8 |
| Molecular Weight | 756.82 g/mol |
| Exact Mass | 756.29 |
| IUPAC Name | N-[9-[(2R,3R,4R,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3-(2-cyanoethoxy)-4-hydroxyoxolan-2-yl]purin-6-yl]-2-phenoxyacetamide |
| SMILES | COc1ccc(C(OC[C@H]2O[C@@H](n3cnc4c(NC(=O)COc5ccccc5)ncnc43)[C@H](OCCC#N)[C@@H]2O)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C42H40N6O8/c1-51-31-18-14-29(15-19-31)42(28-10-5-3-6-11-28,30-16-20-32(52-2)21-17-30)55-24-34-37(50)38(53-23-9-22-43)41(56-34)48-27-46-36-39(44-26-45-40(36)48)47-35(49)25-54-33-12-7-4-8-13-33/h3-8,10-21,26-27,34,37-38,41,50H,9,23-25H2,1-2H3,(H,44,45,47,49)/t34-,37-,38-,41-/m1/s1 |
| InChIKey | CWXBLBSJSFOWOT-VYRNGDHESA-N |
| XLogP | 5.43 |
| TPSA | 172.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 756.82 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|