C38H36N6O5 — CID 102034311
N-[9-[(2R,4S,5S)-4-amino-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]oxolan-2-yl]purin-6-yl]benzamide (PubChem CID 102034311) has the molecular formula C38H36N6O5 and a molecular weight of 656.74 g/mol. Its IUPAC name is N-[9-[(2R,4S,5S)-4-amino-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]oxolan-2-yl]purin-6-yl]benzamide.
| Compound Name | N-[9-[(2R,4S,5S)-4-amino-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]oxolan-2-yl]purin-6-yl]benzamide |
|---|---|
| PubChem CID | 102034311 |
| Molecular Formula | C38H36N6O5 |
| Molecular Weight | 656.74 g/mol |
| Exact Mass | 656.27 |
| IUPAC Name | N-[9-[(2R,4S,5S)-4-amino-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]oxolan-2-yl]purin-6-yl]benzamide |
| SMILES | COc1ccc(C(OC[C@H]2O[C@@H](n3cnc4c(NC(=O)c5ccccc5)ncnc43)C[C@@H]2N)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C38H36N6O5/c1-46-29-17-13-27(14-18-29)38(26-11-7-4-8-12-26,28-15-19-30(47-2)20-16-28)48-22-32-31(39)21-33(49-32)44-24-42-34-35(40-23-41-36(34)44)43-37(45)25-9-5-3-6-10-25/h3-20,23-24,31-33H,21-22,39H2,1-2H3,(H,40,41,43,45)/t31-,32+,33+/m0/s1 |
| InChIKey | YPMPCMFQGRCUFU-WIHCDAFUSA-N |
| XLogP | 5.72 |
| TPSA | 135.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.74 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|