C39H37N5O8P+ — CID 14778857
[(2R,3S,5R)-5-(6-benzamidopurin-9-yl)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]oxolan-3-yl]oxy-methoxy-oxophosphanium (PubChem CID 14778857) has the molecular formula C39H37N5O8P+ and a molecular weight of 734.73 g/mol. Its IUPAC name is [(2R,3S,5R)-5-(6-benzamidopurin-9-yl)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]oxolan-3-yl]oxy-methoxy-oxophosphanium.
| Compound Name | [(2R,3S,5R)-5-(6-benzamidopurin-9-yl)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]oxolan-3-yl]oxy-methoxy-oxophosphanium |
|---|---|
| PubChem CID | 14778857 |
| Molecular Formula | C39H37N5O8P+ |
| Molecular Weight | 734.73 g/mol |
| Exact Mass | 734.24 |
| IUPAC Name | [(2R,3S,5R)-5-(6-benzamidopurin-9-yl)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]oxolan-3-yl]oxy-methoxy-oxophosphanium |
| SMILES | COc1ccc(C(OC[C@H]2O[C@@H](n3cnc4c(NC(=O)c5ccccc5)ncnc43)C[C@@H]2O[P+](=O)OC)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C39H36N5O8P/c1-47-30-18-14-28(15-19-30)39(27-12-8-5-9-13-27,29-16-20-31(48-2)21-17-29)50-23-33-32(52-53(46)49-3)22-34(51-33)44-25-42-35-36(40-24-41-37(35)44)43-38(45)26-10-6-4-7-11-26/h4-21,24-25,32-34H,22-23H2,1-3H3/p+1/t32-,33+,34+/m0/s1 |
| InChIKey | KVFFSWXUVIGEPC-LBFZIJHGSA-O |
| XLogP | 7.08 |
| TPSA | 145.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.73 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|