C40H40N5O7PSe — CID 10417949
N-[9-[(2R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-[methyl(methylselanyl)phosphoryl]oxyoxolan-2-yl]purin-6-yl]benzamide (PubChem CID 10417949) has the molecular formula C40H40N5O7PSe and a molecular weight of 812.72 g/mol. Its IUPAC name is N-[9-[(2R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-[methyl(methylselanyl)phosphoryl]oxyoxolan-2-yl]purin-6-yl]benzamide.
| Compound Name | N-[9-[(2R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-[methyl(methylselanyl)phosphoryl]oxyoxolan-2-yl]purin-6-yl]benzamide |
|---|---|
| PubChem CID | 10417949 |
| Molecular Formula | C40H40N5O7PSe |
| Molecular Weight | 812.72 g/mol |
| Exact Mass | 813.18 |
| IUPAC Name | N-[9-[(2R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-[methyl(methylselanyl)phosphoryl]oxyoxolan-2-yl]purin-6-yl]benzamide |
| SMILES | COc1ccc(C(OC[C@H]2O[C@@H](n3cnc4c(NC(=O)c5ccccc5)ncnc43)C[C@@H]2O[P@@](C)(=O)[Se]C)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C40H40N5O7PSe/c1-48-31-19-15-29(16-20-31)40(28-13-9-6-10-14-28,30-17-21-32(49-2)22-18-30)50-24-34-33(52-53(3,47)54-4)23-35(51-34)45-26-43-36-37(41-25-42-38(36)45)44-39(46)27-11-7-5-8-12-27/h5-22,25-26,33-35H,23-24H2,1-4H3,(H,41,42,44,46)/t33-,34+,35+,53+/m0/s1 |
| InChIKey | ICIFQTMKYSFGAN-CKTCEHSJSA-N |
| XLogP | 7.35 |
| TPSA | 135.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 812.72 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|