C41H39N6O9P — CID 11216542
[(2R,3S,5R)-5-(6-benzamidopurin-9-yl)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]oxolan-3-yl] 2-cyanoethyl hydrogen phosphate (PubChem CID 11216542) has the molecular formula C41H39N6O9P and a molecular weight of 790.77 g/mol. Its IUPAC name is [(2R,3S,5R)-5-(6-benzamidopurin-9-yl)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]oxolan-3-yl] 2-cyanoethyl hydrogen phosphate.
| Compound Name | [(2R,3S,5R)-5-(6-benzamidopurin-9-yl)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]oxolan-3-yl] 2-cyanoethyl hydrogen phosphate |
|---|---|
| PubChem CID | 11216542 |
| Molecular Formula | C41H39N6O9P |
| Molecular Weight | 790.77 g/mol |
| Exact Mass | 790.25 |
| IUPAC Name | [(2R,3S,5R)-5-(6-benzamidopurin-9-yl)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]oxolan-3-yl] 2-cyanoethyl hydrogen phosphate |
| SMILES | COc1ccc(C(OC[C@H]2O[C@@H](n3cnc4c(NC(=O)c5ccccc5)ncnc43)C[C@@H]2OP(=O)(O)OCCC#N)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C41H39N6O9P/c1-51-32-18-14-30(15-19-32)41(29-12-7-4-8-13-29,31-16-20-33(52-2)21-17-31)53-25-35-34(56-57(49,50)54-23-9-22-42)24-36(55-35)47-27-45-37-38(43-26-44-39(37)47)46-40(48)28-10-5-3-6-11-28/h3-8,10-21,26-27,34-36H,9,23-25H2,1-2H3,(H,49,50)(H,43,44,46,48)/t34-,35+,36+/m0/s1 |
| InChIKey | GVJYCYIQUSHMRT-LIVOIKKVSA-N |
| XLogP | 6.81 |
| TPSA | 189.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 790.77 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|