C39H37FN5O7P — CID 10628795
N-[9-[(2R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-[fluoro(methyl)phosphoryl]oxyoxolan-2-yl]purin-6-yl]benzamide (PubChem CID 10628795) has the molecular formula C39H37FN5O7P and a molecular weight of 737.73 g/mol. Its IUPAC name is N-[9-[(2R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-[fluoro(methyl)phosphoryl]oxyoxolan-2-yl]purin-6-yl]benzamide.
| Compound Name | N-[9-[(2R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-[fluoro(methyl)phosphoryl]oxyoxolan-2-yl]purin-6-yl]benzamide |
|---|---|
| PubChem CID | 10628795 |
| Molecular Formula | C39H37FN5O7P |
| Molecular Weight | 737.73 g/mol |
| Exact Mass | 737.24 |
| IUPAC Name | N-[9-[(2R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-[fluoro(methyl)phosphoryl]oxyoxolan-2-yl]purin-6-yl]benzamide |
| SMILES | COc1ccc(C(OC[C@H]2O[C@@H](n3cnc4c(NC(=O)c5ccccc5)ncnc43)C[C@@H]2OP(C)(=O)F)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C39H37FN5O7P/c1-48-30-18-14-28(15-19-30)39(27-12-8-5-9-13-27,29-16-20-31(49-2)21-17-29)50-23-33-32(52-53(3,40)47)22-34(51-33)45-25-43-35-36(41-24-42-37(35)45)44-38(46)26-10-6-4-7-11-26/h4-21,24-25,32-34H,22-23H2,1-3H3,(H,41,42,44,46)/t32-,33+,34+,53?/m0/s1 |
| InChIKey | CDSBPMWOKLLQTM-SHQZTPLTSA-N |
| XLogP | 7.57 |
| TPSA | 135.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 737.73 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|