C38H35N5O4S — CID 140943592
N-[9-[(2R,4S,5R)-4-(methylsulfanylmethoxy)-5-(trityloxymethyl)oxolan-2-yl]purin-6-yl]benzamide (PubChem CID 140943592) has the molecular formula C38H35N5O4S and a molecular weight of 657.80 g/mol. Its IUPAC name is N-[9-[(2R,4S,5R)-4-(methylsulfanylmethoxy)-5-(trityloxymethyl)oxolan-2-yl]purin-6-yl]benzamide.
| Compound Name | N-[9-[(2R,4S,5R)-4-(methylsulfanylmethoxy)-5-(trityloxymethyl)oxolan-2-yl]purin-6-yl]benzamide |
|---|---|
| PubChem CID | 140943592 |
| Molecular Formula | C38H35N5O4S |
| Molecular Weight | 657.80 g/mol |
| Exact Mass | 657.24 |
| IUPAC Name | N-[9-[(2R,4S,5R)-4-(methylsulfanylmethoxy)-5-(trityloxymethyl)oxolan-2-yl]purin-6-yl]benzamide |
| SMILES | CSCO[C@H]1C[C@H](n2cnc3c(NC(=O)c4ccccc4)ncnc32)O[C@@H]1COC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C38H35N5O4S/c1-48-26-45-31-22-33(43-25-41-34-35(39-24-40-36(34)43)42-37(44)27-14-6-2-7-15-27)47-32(31)23-46-38(28-16-8-3-9-17-28,29-18-10-4-11-19-29)30-20-12-5-13-21-30/h2-21,24-25,31-33H,22-23,26H2,1H3,(H,39,40,42,44)/t31-,32+,33+/m0/s1 |
| InChIKey | JESGTAGZAWDYGT-WIHCDAFUSA-N |
| XLogP | 7.08 |
| TPSA | 100.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.80 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|