C31H45N5O5S2Si — CID 147084956
N-[9-[(2R,4R,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-[[(2-methyl-5-oxohexan-2-yl)disulfanyl]methoxy]oxolan-2-yl]purin-6-yl]benzamide (PubChem CID 147084956) has the molecular formula C31H45N5O5S2Si and a molecular weight of 659.95 g/mol. Its IUPAC name is N-[9-[(2R,4R,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-[[(2-methyl-5-oxohexan-2-yl)disulfanyl]methoxy]oxolan-2-yl]purin-6-yl]benzamide.
| Compound Name | N-[9-[(2R,4R,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-[[(2-methyl-5-oxohexan-2-yl)disulfanyl]methoxy]oxolan-2-yl]purin-6-yl]benzamide |
|---|---|
| PubChem CID | 147084956 |
| Molecular Formula | C31H45N5O5S2Si |
| Molecular Weight | 659.95 g/mol |
| Exact Mass | 659.26 |
| IUPAC Name | N-[9-[(2R,4R,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-[[(2-methyl-5-oxohexan-2-yl)disulfanyl]methoxy]oxolan-2-yl]purin-6-yl]benzamide |
| SMILES | CC(=O)CCC(C)(C)SSCO[C@@H]1C[C@H](n2cnc3c(NC(=O)c4ccccc4)ncnc32)O[C@@H]1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C31H45N5O5S2Si/c1-21(37)14-15-31(5,6)43-42-20-39-23-16-25(41-24(23)17-40-44(7,8)30(2,3)4)36-19-34-26-27(32-18-33-28(26)36)35-29(38)22-12-10-9-11-13-22/h9-13,18-19,23-25H,14-17,20H2,1-8H3,(H,32,33,35,38)/t23-,24-,25-/m1/s1 |
| InChIKey | BHQOSILNFRCYLB-UBFVSLLYSA-N |
| XLogP | 7.26 |
| TPSA | 117.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.95 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|