C23H30FN5O4Si — CID 142536252
N-[9-[(2R,3S,4R,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-fluoro-3-hydroxyoxolan-2-yl]purin-6-yl]benzamide (PubChem CID 142536252) has the molecular formula C23H30FN5O4Si and a molecular weight of 487.61 g/mol. Its IUPAC name is N-[9-[(2R,3S,4R,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-fluoro-3-hydroxyoxolan-2-yl]purin-6-yl]benzamide.
| Compound Name | N-[9-[(2R,3S,4R,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-fluoro-3-hydroxyoxolan-2-yl]purin-6-yl]benzamide |
|---|---|
| PubChem CID | 142536252 |
| Molecular Formula | C23H30FN5O4Si |
| Molecular Weight | 487.61 g/mol |
| Exact Mass | 487.21 |
| IUPAC Name | N-[9-[(2R,3S,4R,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-fluoro-3-hydroxyoxolan-2-yl]purin-6-yl]benzamide |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](n2cnc3c(NC(=O)c4ccccc4)ncnc32)[C@H](O)[C@H]1F |
| InChI | InChI=1S/C23H30FN5O4Si/c1-23(2,3)34(4,5)32-11-15-16(24)18(30)22(33-15)29-13-27-17-19(25-12-26-20(17)29)28-21(31)14-9-7-6-8-10-14/h6-10,12-13,15-16,18,22,30H,11H2,1-5H3,(H,25,26,28,31)/t15-,16+,18-,22-/m1/s1 |
| InChIKey | BPNYKTDEZNHSSK-UNMKOGDSSA-N |
| XLogP | 3.70 |
| TPSA | 111.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.61 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|