C30H47N5O8SSi2 — CID 174106765
[5-(6-benzamidopurin-9-yl)-4-[tert-butyl(dimethyl)silyl]oxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-3-yl] methyl sulfate (PubChem CID 174106765) has the molecular formula C30H47N5O8SSi2 and a molecular weight of 693.97 g/mol. Its IUPAC name is [5-(6-benzamidopurin-9-yl)-4-[tert-butyl(dimethyl)silyl]oxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-3-yl] methyl sulfate.
| Compound Name | [5-(6-benzamidopurin-9-yl)-4-[tert-butyl(dimethyl)silyl]oxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-3-yl] methyl sulfate |
|---|---|
| PubChem CID | 174106765 |
| Molecular Formula | C30H47N5O8SSi2 |
| Molecular Weight | 693.97 g/mol |
| Exact Mass | 693.27 |
| IUPAC Name | [5-(6-benzamidopurin-9-yl)-4-[tert-butyl(dimethyl)silyl]oxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-3-yl] methyl sulfate |
| SMILES | COS(=O)(=O)OC1C(CO[Si](C)(C)C(C)(C)C)OC(n2cnc3c(NC(=O)c4ccccc4)ncnc32)C1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C30H47N5O8SSi2/c1-29(2,3)45(8,9)40-17-21-23(42-44(37,38)39-7)24(43-46(10,11)30(4,5)6)28(41-21)35-19-33-22-25(31-18-32-26(22)35)34-27(36)20-15-13-12-14-16-20/h12-16,18-19,21,23-24,28H,17H2,1-11H3,(H,31,32,34,36) |
| InChIKey | QONIDZNTENTDPM-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 152.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.97 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|