C35H61N5O4Si3 — CID 135015311
N-benzyl-9-[(2R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]purin-6-amine (PubChem CID 135015311) has the molecular formula C35H61N5O4Si3 and a molecular weight of 700.16 g/mol. Its IUPAC name is N-benzyl-9-[(2R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]purin-6-amine.
| Compound Name | N-benzyl-9-[(2R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]purin-6-amine |
|---|---|
| PubChem CID | 135015311 |
| Molecular Formula | C35H61N5O4Si3 |
| Molecular Weight | 700.16 g/mol |
| Exact Mass | 699.40 |
| IUPAC Name | N-benzyl-9-[(2R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]purin-6-amine |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](n2cnc3c(NCc4ccccc4)ncnc32)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C35H61N5O4Si3/c1-33(2,3)45(10,11)41-22-26-28(43-46(12,13)34(4,5)6)29(44-47(14,15)35(7,8)9)32(42-26)40-24-39-27-30(37-23-38-31(27)40)36-21-25-19-17-16-18-20-25/h16-20,23-24,26,28-29,32H,21-22H2,1-15H3,(H,36,37,38)/t26-,28?,29?,32-/m1/s1 |
| InChIKey | JOGAOIJXZPGLCL-DLAWUUKPSA-N |
| XLogP | 9.14 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.16 |
| LogP ≤ 5 | 9.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|