C32H52N8O5Si2 — CID 56950105
1-benzyl-3-[9-[(2R,3R,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[(methylcarbamoylamino)methyl]oxolan-2-yl]purin-6-yl]urea (PubChem CID 56950105) has the molecular formula C32H52N8O5Si2 and a molecular weight of 684.99 g/mol. Its IUPAC name is 1-benzyl-3-[9-[(2R,3R,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[(methylcarbamoylamino)methyl]oxolan-2-yl]purin-6-yl]urea.
| Compound Name | 1-benzyl-3-[9-[(2R,3R,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[(methylcarbamoylamino)methyl]oxolan-2-yl]purin-6-yl]urea |
|---|---|
| PubChem CID | 56950105 |
| Molecular Formula | C32H52N8O5Si2 |
| Molecular Weight | 684.99 g/mol |
| Exact Mass | 684.36 |
| IUPAC Name | 1-benzyl-3-[9-[(2R,3R,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[(methylcarbamoylamino)methyl]oxolan-2-yl]purin-6-yl]urea |
| SMILES | CNC(=O)NC[C@H]1O[C@@H](n2cnc3c(NC(=O)NCc4ccccc4)ncnc32)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C32H52N8O5Si2/c1-31(2,3)46(8,9)44-24-22(18-35-29(41)33-7)43-28(25(24)45-47(10,11)32(4,5)6)40-20-38-23-26(36-19-37-27(23)40)39-30(42)34-17-21-15-13-12-14-16-21/h12-16,19-20,22,24-25,28H,17-18H2,1-11H3,(H2,33,35,41)(H2,34,36,37,39,42)/t22-,24-,25-,28-/m1/s1 |
| InChIKey | BXFGDYWLJUVKRK-ZYWWQZICSA-N |
| XLogP | 5.76 |
| TPSA | 153.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.99 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|