C32H51N7O7Si2 — CID 57395256
[(2R,3R,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[6-[(4-methoxyphenyl)carbamoylamino]purin-9-yl]oxolan-2-yl]methyl N-methylcarbamate (PubChem CID 57395256) has the molecular formula C32H51N7O7Si2 and a molecular weight of 701.97 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[6-[(4-methoxyphenyl)carbamoylamino]purin-9-yl]oxolan-2-yl]methyl N-methylcarbamate.
| Compound Name | [(2R,3R,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[6-[(4-methoxyphenyl)carbamoylamino]purin-9-yl]oxolan-2-yl]methyl N-methylcarbamate |
|---|---|
| PubChem CID | 57395256 |
| Molecular Formula | C32H51N7O7Si2 |
| Molecular Weight | 701.97 g/mol |
| Exact Mass | 701.34 |
| IUPAC Name | [(2R,3R,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[6-[(4-methoxyphenyl)carbamoylamino]purin-9-yl]oxolan-2-yl]methyl N-methylcarbamate |
| SMILES | CNC(=O)OC[C@H]1O[C@@H](n2cnc3c(NC(=O)Nc4ccc(OC)cc4)ncnc32)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C32H51N7O7Si2/c1-31(2,3)47(9,10)45-24-22(17-43-30(41)33-7)44-28(25(24)46-48(11,12)32(4,5)6)39-19-36-23-26(34-18-35-27(23)39)38-29(40)37-20-13-15-21(42-8)16-14-20/h13-16,18-19,22,24-25,28H,17H2,1-12H3,(H,33,41)(H2,34,35,37,38,40)/t22-,24-,25-,28-/m1/s1 |
| InChIKey | JERNWCJZAGFOSI-ZYWWQZICSA-N |
| XLogP | 6.51 |
| TPSA | 159.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.97 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|