C33H63N5O4Si3 — CID 135015562
9-[(2R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]-N-cyclopentylpurin-6-amine (PubChem CID 135015562) has the molecular formula C33H63N5O4Si3 and a molecular weight of 678.16 g/mol. Its IUPAC name is 9-[(2R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]-N-cyclopentylpurin-6-amine.
| Compound Name | 9-[(2R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]-N-cyclopentylpurin-6-amine |
|---|---|
| PubChem CID | 135015562 |
| Molecular Formula | C33H63N5O4Si3 |
| Molecular Weight | 678.16 g/mol |
| Exact Mass | 677.42 |
| IUPAC Name | 9-[(2R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]-N-cyclopentylpurin-6-amine |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](n2cnc3c(NC4CCCC4)ncnc32)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C33H63N5O4Si3/c1-31(2,3)43(10,11)39-20-24-26(41-44(12,13)32(4,5)6)27(42-45(14,15)33(7,8)9)30(40-24)38-22-36-25-28(34-21-35-29(25)38)37-23-18-16-17-19-23/h21-24,26-27,30H,16-20H2,1-15H3,(H,34,35,37)/t24-,26?,27?,30-/m1/s1 |
| InChIKey | ZHCYDNVELDQEPT-LOFJPGAYSA-N |
| XLogP | 8.88 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.16 |
| LogP ≤ 5 | 8.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|