C32H56N4O4SSi3 — CID 11828548
[(2R,3R,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-(6-thiophen-2-ylpurin-9-yl)oxolan-2-yl]methoxy-tert-butyl-dimethylsilane (PubChem CID 11828548) has the molecular formula C32H56N4O4SSi3 and a molecular weight of 677.15 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-(6-thiophen-2-ylpurin-9-yl)oxolan-2-yl]methoxy-tert-butyl-dimethylsilane.
| Compound Name | [(2R,3R,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-(6-thiophen-2-ylpurin-9-yl)oxolan-2-yl]methoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 11828548 |
| Molecular Formula | C32H56N4O4SSi3 |
| Molecular Weight | 677.15 g/mol |
| Exact Mass | 676.33 |
| IUPAC Name | [(2R,3R,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-(6-thiophen-2-ylpurin-9-yl)oxolan-2-yl]methoxy-tert-butyl-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](n2cnc3c(-c4cccs4)ncnc32)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C32H56N4O4SSi3/c1-30(2,3)42(10,11)37-19-22-26(39-43(12,13)31(4,5)6)27(40-44(14,15)32(7,8)9)29(38-22)36-21-35-25-24(23-17-16-18-41-23)33-20-34-28(25)36/h16-18,20-22,26-27,29H,19H2,1-15H3/t22-,26-,27-,29-/m1/s1 |
| InChIKey | WLJBREQWYLJPHN-XGELUGHYSA-N |
| XLogP | 9.25 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.15 |
| LogP ≤ 5 | 9.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|