C25H45N5O4Si2 — CID 175677046
9-[(2R,3R,4R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-prop-2-enoxyoxolan-2-yl]purin-6-amine (PubChem CID 175677046) has the molecular formula C25H45N5O4Si2 and a molecular weight of 535.84 g/mol. Its IUPAC name is 9-[(2R,3R,4R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-prop-2-enoxyoxolan-2-yl]purin-6-amine.
| Compound Name | 9-[(2R,3R,4R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-prop-2-enoxyoxolan-2-yl]purin-6-amine |
|---|---|
| PubChem CID | 175677046 |
| Molecular Formula | C25H45N5O4Si2 |
| Molecular Weight | 535.84 g/mol |
| Exact Mass | 535.30 |
| IUPAC Name | 9-[(2R,3R,4R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-prop-2-enoxyoxolan-2-yl]purin-6-amine |
| SMILES | C=CCO[C@H]1[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](n2cnc3c(N)ncnc32)O[C@@H]1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H45N5O4Si2/c1-12-13-31-19-17(14-32-35(8,9)24(2,3)4)33-23(20(19)34-36(10,11)25(5,6)7)30-16-29-18-21(26)27-15-28-22(18)30/h12,15-17,19-20,23H,1,13-14H2,2-11H3,(H2,26,27,28)/t17-,19-,20-,23-/m1/s1 |
| InChIKey | LZTUKWFZUVQULE-ZDXOVATRSA-N |
| XLogP | 5.29 |
| TPSA | 106.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.84 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|