C17H29N5O4Si — CID 11069295
(2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-methoxyoxolan-3-ol (PubChem CID 11069295) has the molecular formula C17H29N5O4Si and a molecular weight of 395.54 g/mol. Its IUPAC name is (2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-methoxyoxolan-3-ol.
| Compound Name | (2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-methoxyoxolan-3-ol |
|---|---|
| PubChem CID | 11069295 |
| Molecular Formula | C17H29N5O4Si |
| Molecular Weight | 395.54 g/mol |
| Exact Mass | 395.20 |
| IUPAC Name | (2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-methoxyoxolan-3-ol |
| SMILES | CO[C@@H]1[C@H](O)[C@@H](CO[Si](C)(C)C(C)(C)C)O[C@H]1n1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C17H29N5O4Si/c1-17(2,3)27(5,6)25-7-10-12(23)13(24-4)16(26-10)22-9-21-11-14(18)19-8-20-15(11)22/h8-10,12-13,16,23H,7H2,1-6H3,(H2,18,19,20)/t10-,12-,13-,16-/m1/s1 |
| InChIKey | HLWZQOUDJSHRPD-XNIJJKJLSA-N |
| XLogP | 1.70 |
| TPSA | 117.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.54 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|