C12H17N5O4 — CID 19076332
5-(6-aminopurin-9-yl)-4-methoxy-2-(methoxymethyl)oxolan-3-ol (PubChem CID 19076332) has the molecular formula C12H17N5O4 and a molecular weight of 295.30 g/mol. Its IUPAC name is 5-(6-aminopurin-9-yl)-4-methoxy-2-(methoxymethyl)oxolan-3-ol.
| Compound Name | 5-(6-aminopurin-9-yl)-4-methoxy-2-(methoxymethyl)oxolan-3-ol |
|---|---|
| PubChem CID | 19076332 |
| Molecular Formula | C12H17N5O4 |
| Molecular Weight | 295.30 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | 5-(6-aminopurin-9-yl)-4-methoxy-2-(methoxymethyl)oxolan-3-ol |
| SMILES | COCC1OC(n2cnc3c(N)ncnc32)C(OC)C1O |
| InChI | InChI=1S/C12H17N5O4/c1-19-3-6-8(18)9(20-2)12(21-6)17-5-16-7-10(13)14-4-15-11(7)17/h4-6,8-9,12,18H,3H2,1-2H3,(H2,13,14,15) |
| InChIKey | ULQYCJVGLOQHJT-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 117.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.30 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |