C25H27N5O4 — CID 18642999
(2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-2-(2,2-diphenylethoxymethyl)-4-methoxyoxolan-3-ol (PubChem CID 18642999) has the molecular formula C25H27N5O4 and a molecular weight of 461.52 g/mol. Its IUPAC name is (2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-2-(2,2-diphenylethoxymethyl)-4-methoxyoxolan-3-ol.
| Compound Name | (2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-2-(2,2-diphenylethoxymethyl)-4-methoxyoxolan-3-ol |
|---|---|
| PubChem CID | 18642999 |
| Molecular Formula | C25H27N5O4 |
| Molecular Weight | 461.52 g/mol |
| Exact Mass | 461.21 |
| IUPAC Name | (2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-2-(2,2-diphenylethoxymethyl)-4-methoxyoxolan-3-ol |
| SMILES | CO[C@@H]1[C@H](O)[C@@H](COCC(c2ccccc2)c2ccccc2)O[C@H]1n1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C25H27N5O4/c1-32-22-21(31)19(34-25(22)30-15-29-20-23(26)27-14-28-24(20)30)13-33-12-18(16-8-4-2-5-9-16)17-10-6-3-7-11-17/h2-11,14-15,18-19,21-22,25,31H,12-13H2,1H3,(H2,26,27,28)/t19-,21-,22-,25-/m1/s1 |
| InChIKey | PQQQOMHXWHRDAE-PTGPVQHPSA-N |
| XLogP | 2.53 |
| TPSA | 117.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.52 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |