C36H37N5O4Si2 — CID 24866592
(2R,3R,4S,5R)-5-(6-aminopurin-9-yl)-4-[methyl(diphenyl)silyl]oxy-2-[[methyl(diphenyl)silyl]oxymethyl]oxolan-3-ol (PubChem CID 24866592) has the molecular formula C36H37N5O4Si2 and a molecular weight of 659.90 g/mol. Its IUPAC name is (2R,3R,4S,5R)-5-(6-aminopurin-9-yl)-4-[methyl(diphenyl)silyl]oxy-2-[[methyl(diphenyl)silyl]oxymethyl]oxolan-3-ol.
| Compound Name | (2R,3R,4S,5R)-5-(6-aminopurin-9-yl)-4-[methyl(diphenyl)silyl]oxy-2-[[methyl(diphenyl)silyl]oxymethyl]oxolan-3-ol |
|---|---|
| PubChem CID | 24866592 |
| Molecular Formula | C36H37N5O4Si2 |
| Molecular Weight | 659.90 g/mol |
| Exact Mass | 659.24 |
| IUPAC Name | (2R,3R,4S,5R)-5-(6-aminopurin-9-yl)-4-[methyl(diphenyl)silyl]oxy-2-[[methyl(diphenyl)silyl]oxymethyl]oxolan-3-ol |
| SMILES | C[Si](OC[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@@H](O[Si](C)(c2ccccc2)c2ccccc2)[C@@H]1O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C36H37N5O4Si2/c1-46(26-15-7-3-8-16-26,27-17-9-4-10-18-27)43-23-30-32(42)33(36(44-30)41-25-40-31-34(37)38-24-39-35(31)41)45-47(2,28-19-11-5-12-20-28)29-21-13-6-14-22-29/h3-22,24-25,30,32-33,36,42H,23H2,1-2H3,(H2,37,38,39)/t30-,32-,33+,36-/m1/s1 |
| InChIKey | PDLLPQVIRVBBSF-MZONXJPGSA-N |
| XLogP | 2.85 |
| TPSA | 117.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.90 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|