C18H22N6O4 — CID 25173333
(2R,3S,4R,5R)-2-[(2-amino-2-phenylethoxy)methyl]-5-(6-aminopurin-9-yl)oxolane-3,4-diol (PubChem CID 25173333) has the molecular formula C18H22N6O4 and a molecular weight of 386.41 g/mol. Its IUPAC name is (2R,3S,4R,5R)-2-[(2-amino-2-phenylethoxy)methyl]-5-(6-aminopurin-9-yl)oxolane-3,4-diol.
| Compound Name | (2R,3S,4R,5R)-2-[(2-amino-2-phenylethoxy)methyl]-5-(6-aminopurin-9-yl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 25173333 |
| Molecular Formula | C18H22N6O4 |
| Molecular Weight | 386.41 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | (2R,3S,4R,5R)-2-[(2-amino-2-phenylethoxy)methyl]-5-(6-aminopurin-9-yl)oxolane-3,4-diol |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](COCC(N)c2ccccc2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C18H22N6O4/c19-11(10-4-2-1-3-5-10)6-27-7-12-14(25)15(26)18(28-12)24-9-23-13-16(20)21-8-22-17(13)24/h1-5,8-9,11-12,14-15,18,25-26H,6-7,19H2,(H2,20,21,22)/t11?,12-,14-,15-,18-/m1/s1 |
| InChIKey | ABXRVSAFBXMBCM-JJPFLPBXSA-N |
| XLogP | -0.26 |
| TPSA | 154.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.41 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |