C19H33N5O4Si — CID 67165594
(2R,3S,4S,5R)-2-(6-aminopurin-9-yl)-5-[tri(propan-2-yl)silyloxymethyl]oxolane-3,4-diol (PubChem CID 67165594) has the molecular formula C19H33N5O4Si and a molecular weight of 423.59 g/mol. Its IUPAC name is (2R,3S,4S,5R)-2-(6-aminopurin-9-yl)-5-[tri(propan-2-yl)silyloxymethyl]oxolane-3,4-diol.
| Compound Name | (2R,3S,4S,5R)-2-(6-aminopurin-9-yl)-5-[tri(propan-2-yl)silyloxymethyl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 67165594 |
| Molecular Formula | C19H33N5O4Si |
| Molecular Weight | 423.59 g/mol |
| Exact Mass | 423.23 |
| IUPAC Name | (2R,3S,4S,5R)-2-(6-aminopurin-9-yl)-5-[tri(propan-2-yl)silyloxymethyl]oxolane-3,4-diol |
| SMILES | CC(C)[Si](OC[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@@H](O)[C@@H]1O)(C(C)C)C(C)C |
| InChI | InChI=1S/C19H33N5O4Si/c1-10(2)29(11(3)4,12(5)6)27-7-13-15(25)16(26)19(28-13)24-9-23-14-17(20)21-8-22-18(14)24/h8-13,15-16,19,25-26H,7H2,1-6H3,(H2,20,21,22)/t13-,15-,16+,19-/m1/s1 |
| InChIKey | UUPJQXPYQJEJDR-JNNRSPCRSA-N |
| XLogP | 2.22 |
| TPSA | 128.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.59 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|