C17H27N5O6 — CID 155196415
9-[(2R,3R,4R,5R)-3-(2-ethoxyethoxymethoxy)-4-methoxy-5-(methoxymethyl)oxolan-2-yl]purin-6-amine (PubChem CID 155196415) has the molecular formula C17H27N5O6 and a molecular weight of 397.43 g/mol. Its IUPAC name is 9-[(2R,3R,4R,5R)-3-(2-ethoxyethoxymethoxy)-4-methoxy-5-(methoxymethyl)oxolan-2-yl]purin-6-amine.
| Compound Name | 9-[(2R,3R,4R,5R)-3-(2-ethoxyethoxymethoxy)-4-methoxy-5-(methoxymethyl)oxolan-2-yl]purin-6-amine |
|---|---|
| PubChem CID | 155196415 |
| Molecular Formula | C17H27N5O6 |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.20 |
| IUPAC Name | 9-[(2R,3R,4R,5R)-3-(2-ethoxyethoxymethoxy)-4-methoxy-5-(methoxymethyl)oxolan-2-yl]purin-6-amine |
| SMILES | CCOCCOCO[C@@H]1[C@H](OC)[C@@H](COC)O[C@H]1n1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C17H27N5O6/c1-4-25-5-6-26-10-27-14-13(24-3)11(7-23-2)28-17(14)22-9-21-12-15(18)19-8-20-16(12)22/h8-9,11,13-14,17H,4-7,10H2,1-3H3,(H2,18,19,20)/t11-,13-,14-,17-/m1/s1 |
| InChIKey | FUHBDKWWQQQTKO-LSCFUAHRSA-N |
| XLogP | 0.36 |
| TPSA | 125.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|