C15H25N6O9P — CID 166026157
[(2R,3R,4R,5R)-4-[2-(2-aminoethoxy)ethoxymethoxy]-5-(6-aminopurin-9-yl)-2-(hydroxymethyl)oxolan-3-yl] dihydrogen phosphate (PubChem CID 166026157) has the molecular formula C15H25N6O9P and a molecular weight of 464.37 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-4-[2-(2-aminoethoxy)ethoxymethoxy]-5-(6-aminopurin-9-yl)-2-(hydroxymethyl)oxolan-3-yl] dihydrogen phosphate.
| Compound Name | [(2R,3R,4R,5R)-4-[2-(2-aminoethoxy)ethoxymethoxy]-5-(6-aminopurin-9-yl)-2-(hydroxymethyl)oxolan-3-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 166026157 |
| Molecular Formula | C15H25N6O9P |
| Molecular Weight | 464.37 g/mol |
| Exact Mass | 464.14 |
| IUPAC Name | [(2R,3R,4R,5R)-4-[2-(2-aminoethoxy)ethoxymethoxy]-5-(6-aminopurin-9-yl)-2-(hydroxymethyl)oxolan-3-yl] dihydrogen phosphate |
| SMILES | NCCOCCOCO[C@@H]1[C@H](OP(=O)(O)O)[C@@H](CO)O[C@H]1n1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C15H25N6O9P/c16-1-2-26-3-4-27-8-28-12-11(30-31(23,24)25)9(5-22)29-15(12)21-7-20-10-13(17)18-6-19-14(10)21/h6-7,9,11-12,15,22H,1-5,8,16H2,(H2,17,18,19)(H2,23,24,25)/t9-,11-,12-,15-/m1/s1 |
| InChIKey | PJMWAKUXIVNOPU-SDBHATRESA-N |
| XLogP | -1.89 |
| TPSA | 219.55 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.37 |
| LogP ≤ 5 | -1.89 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|