C12H15N5O8P- — CID 154585666
[(2R,3R,4R,5R)-4-acetyloxy-5-(6-aminopurin-9-yl)-2-(hydroxymethyl)oxolan-3-yl] hydrogen phosphate (PubChem CID 154585666) has the molecular formula C12H15N5O8P- and a molecular weight of 388.25 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-4-acetyloxy-5-(6-aminopurin-9-yl)-2-(hydroxymethyl)oxolan-3-yl] hydrogen phosphate.
| Compound Name | [(2R,3R,4R,5R)-4-acetyloxy-5-(6-aminopurin-9-yl)-2-(hydroxymethyl)oxolan-3-yl] hydrogen phosphate |
|---|---|
| PubChem CID | 154585666 |
| Molecular Formula | C12H15N5O8P- |
| Molecular Weight | 388.25 g/mol |
| Exact Mass | 388.07 |
| IUPAC Name | [(2R,3R,4R,5R)-4-acetyloxy-5-(6-aminopurin-9-yl)-2-(hydroxymethyl)oxolan-3-yl] hydrogen phosphate |
| SMILES | CC(=O)O[C@@H]1[C@H](OP(=O)([O-])O)[C@@H](CO)O[C@H]1n1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C12H16N5O8P/c1-5(19)23-9-8(25-26(20,21)22)6(2-18)24-12(9)17-4-16-7-10(13)14-3-15-11(7)17/h3-4,6,8-9,12,18H,2H2,1H3,(H2,13,14,15)(H2,20,21,22)/p-1/t6-,8-,9-,12-/m1/s1 |
| InChIKey | OXYXVBSTHBKTSP-WOUKDFQISA-M |
| XLogP | -1.92 |
| TPSA | 194.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.25 |
| LogP ≤ 5 | -1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|