C14H19N5O14P3S- — CID 102348826
[(2R,3R,4R,5R)-4-acetyloxy-5-(6-aminopurin-9-yl)-2-[[[hydroxy(phosphonooxy)phosphoryl]oxy-oxido-sulfidophosphaniumyl]oxymethyl]oxolan-3-yl] acetate (PubChem CID 102348826) has the molecular formula C14H19N5O14P3S- and a molecular weight of 606.32 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-4-acetyloxy-5-(6-aminopurin-9-yl)-2-[[[hydroxy(phosphonooxy)phosphoryl]oxy-oxido-sulfidophosphaniumyl]oxymethyl]oxolan-3-yl] acetate.
| Compound Name | [(2R,3R,4R,5R)-4-acetyloxy-5-(6-aminopurin-9-yl)-2-[[[hydroxy(phosphonooxy)phosphoryl]oxy-oxido-sulfidophosphaniumyl]oxymethyl]oxolan-3-yl] acetate |
|---|---|
| PubChem CID | 102348826 |
| Molecular Formula | C14H19N5O14P3S- |
| Molecular Weight | 606.32 g/mol |
| Exact Mass | 605.99 |
| IUPAC Name | [(2R,3R,4R,5R)-4-acetyloxy-5-(6-aminopurin-9-yl)-2-[[[hydroxy(phosphonooxy)phosphoryl]oxy-oxido-sulfidophosphaniumyl]oxymethyl]oxolan-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@H](OC(C)=O)[C@@H](CO[P+]([O-])([S-])OP(=O)(O)OP(=O)(O)O)O[C@H]1n1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C14H20N5O14P3S/c1-6(20)29-10-8(3-28-36(27,37)33-35(25,26)32-34(22,23)24)31-14(11(10)30-7(2)21)19-5-18-9-12(15)16-4-17-13(9)19/h4-5,8,10-11,14H,3H2,1-2H3,(H,25,26)(H,27,37)(H2,15,16,17)(H2,22,23,24)/p-1/t8-,10-,11-,14-,36?/m1/s1 |
| InChIKey | IJHJYJHULLHENP-TZKCFORQSA-M |
| XLogP | -1.00 |
| TPSA | 277.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.32 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|