C14H16N5O14P3S-4 — CID 102348825
[[[(2R,3R,4R,5R)-3,4-diacetyloxy-5-(6-aminopurin-9-yl)oxolan-2-yl]methoxy-oxido-sulfidophosphaniumyl]oxy-oxidophosphoryl] phosphate (PubChem CID 102348825) has the molecular formula C14H16N5O14P3S-4 and a molecular weight of 603.29 g/mol. Its IUPAC name is [[[(2R,3R,4R,5R)-3,4-diacetyloxy-5-(6-aminopurin-9-yl)oxolan-2-yl]methoxy-oxido-sulfidophosphaniumyl]oxy-oxidophosphoryl] phosphate.
| Compound Name | [[[(2R,3R,4R,5R)-3,4-diacetyloxy-5-(6-aminopurin-9-yl)oxolan-2-yl]methoxy-oxido-sulfidophosphaniumyl]oxy-oxidophosphoryl] phosphate |
|---|---|
| PubChem CID | 102348825 |
| Molecular Formula | C14H16N5O14P3S-4 |
| Molecular Weight | 603.29 g/mol |
| Exact Mass | 602.96 |
| IUPAC Name | [[[(2R,3R,4R,5R)-3,4-diacetyloxy-5-(6-aminopurin-9-yl)oxolan-2-yl]methoxy-oxido-sulfidophosphaniumyl]oxy-oxidophosphoryl] phosphate |
| SMILES | CC(=O)O[C@@H]1[C@H](OC(C)=O)[C@@H](CO[P+]([O-])([S-])OP(=O)([O-])OP(=O)([O-])[O-])O[C@H]1n1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C14H20N5O14P3S/c1-6(20)29-10-8(3-28-36(27,37)33-35(25,26)32-34(22,23)24)31-14(11(10)30-7(2)21)19-5-18-9-12(15)16-4-17-13(9)19/h4-5,8,10-11,14H,3H2,1-2H3,(H,25,26)(H,27,37)(H2,15,16,17)(H2,22,23,24)/p-4/t8-,10-,11-,14-,36?/m1/s1 |
| InChIKey | IJHJYJHULLHENP-TZKCFORQSA-J |
| XLogP | -2.90 |
| TPSA | 285.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 20 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.29 |
| LogP ≤ 5 | -2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 20 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|