C10H12N5O11P3Se-4 — CID 102348823
[[[(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl-oxido-selenidophosphaniumyl]oxy-oxidophosphoryl] phosphate (PubChem CID 102348823) has the molecular formula C10H12N5O11P3Se-4 and a molecular weight of 550.11 g/mol. Its IUPAC name is [[[(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl-oxido-selenidophosphaniumyl]oxy-oxidophosphoryl] phosphate.
| Compound Name | [[[(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl-oxido-selenidophosphaniumyl]oxy-oxidophosphoryl] phosphate |
|---|---|
| PubChem CID | 102348823 |
| Molecular Formula | C10H12N5O11P3Se-4 |
| Molecular Weight | 550.11 g/mol |
| Exact Mass | 550.89 |
| IUPAC Name | [[[(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl-oxido-selenidophosphaniumyl]oxy-oxidophosphoryl] phosphate |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](C[P+]([O-])([Se-])OP(=O)([O-])OP(=O)([O-])[O-])[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C10H16N5O11P3Se/c11-8-5-9(13-2-12-8)15(3-14-5)10-7(17)6(16)4(24-10)1-27(18,30)25-29(22,23)26-28(19,20)21/h2-4,6-7,10,16-17H,1H2,(H,18,30)(H,22,23)(H2,11,12,13)(H2,19,20,21)/p-4/t4-,6-,7-,10-,27?/m1/s1 |
| InChIKey | GATUTZVJGOUCDN-QGPPJTFUSA-J |
| XLogP | -4.35 |
| TPSA | 264.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.11 |
| LogP ≤ 5 | -4.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|