C16H21N5O6S — CID 10409349
[(2S,3S,4R,5R)-4-acetyloxy-5-(6-aminopurin-9-yl)-2-(2-hydroxyethylsulfanylmethyl)oxolan-3-yl] acetate (PubChem CID 10409349) has the molecular formula C16H21N5O6S and a molecular weight of 411.44 g/mol. Its IUPAC name is [(2S,3S,4R,5R)-4-acetyloxy-5-(6-aminopurin-9-yl)-2-(2-hydroxyethylsulfanylmethyl)oxolan-3-yl] acetate.
| Compound Name | [(2S,3S,4R,5R)-4-acetyloxy-5-(6-aminopurin-9-yl)-2-(2-hydroxyethylsulfanylmethyl)oxolan-3-yl] acetate |
|---|---|
| PubChem CID | 10409349 |
| Molecular Formula | C16H21N5O6S |
| Molecular Weight | 411.44 g/mol |
| Exact Mass | 411.12 |
| IUPAC Name | [(2S,3S,4R,5R)-4-acetyloxy-5-(6-aminopurin-9-yl)-2-(2-hydroxyethylsulfanylmethyl)oxolan-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@H](OC(C)=O)[C@@H](CSCCO)O[C@H]1n1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C16H21N5O6S/c1-8(23)25-12-10(5-28-4-3-22)27-16(13(12)26-9(2)24)21-7-20-11-14(17)18-6-19-15(11)21/h6-7,10,12-13,16,22H,3-5H2,1-2H3,(H2,17,18,19)/t10-,12-,13-,16-/m1/s1 |
| InChIKey | JODHHOQFKGYHDT-XNIJJKJLSA-N |
| XLogP | -0.11 |
| TPSA | 151.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.44 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|