C17H22ClN5O5S — CID 11037606
[(2S,3S,4R,5R)-4-acetyloxy-5-(2-amino-6-chloropurin-9-yl)-2-(propylsulfanylmethyl)oxolan-3-yl] acetate (PubChem CID 11037606) has the molecular formula C17H22ClN5O5S and a molecular weight of 443.91 g/mol. Its IUPAC name is [(2S,3S,4R,5R)-4-acetyloxy-5-(2-amino-6-chloropurin-9-yl)-2-(propylsulfanylmethyl)oxolan-3-yl] acetate.
| Compound Name | [(2S,3S,4R,5R)-4-acetyloxy-5-(2-amino-6-chloropurin-9-yl)-2-(propylsulfanylmethyl)oxolan-3-yl] acetate |
|---|---|
| PubChem CID | 11037606 |
| Molecular Formula | C17H22ClN5O5S |
| Molecular Weight | 443.91 g/mol |
| Exact Mass | 443.10 |
| IUPAC Name | [(2S,3S,4R,5R)-4-acetyloxy-5-(2-amino-6-chloropurin-9-yl)-2-(propylsulfanylmethyl)oxolan-3-yl] acetate |
| SMILES | CCCSC[C@H]1O[C@@H](n2cnc3c(Cl)nc(N)nc32)[C@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C17H22ClN5O5S/c1-4-5-29-6-10-12(26-8(2)24)13(27-9(3)25)16(28-10)23-7-20-11-14(18)21-17(19)22-15(11)23/h7,10,12-13,16H,4-6H2,1-3H3,(H2,19,21,22)/t10-,12-,13-,16-/m1/s1 |
| InChIKey | BKFVOYUSQQUEAF-XNIJJKJLSA-N |
| XLogP | 1.97 |
| TPSA | 131.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.91 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|