C27H24ClN5O7 — CID 118465846
[(2S,3R,4R,5R)-4-acetyloxy-5-(2-amino-6-chloropurin-9-yl)-2-(benzoyloxymethyl)oxolan-3-yl]methyl benzoate (PubChem CID 118465846) has the molecular formula C27H24ClN5O7 and a molecular weight of 565.97 g/mol. Its IUPAC name is [(2S,3R,4R,5R)-4-acetyloxy-5-(2-amino-6-chloropurin-9-yl)-2-(benzoyloxymethyl)oxolan-3-yl]methyl benzoate.
| Compound Name | [(2S,3R,4R,5R)-4-acetyloxy-5-(2-amino-6-chloropurin-9-yl)-2-(benzoyloxymethyl)oxolan-3-yl]methyl benzoate |
|---|---|
| PubChem CID | 118465846 |
| Molecular Formula | C27H24ClN5O7 |
| Molecular Weight | 565.97 g/mol |
| Exact Mass | 565.14 |
| IUPAC Name | [(2S,3R,4R,5R)-4-acetyloxy-5-(2-amino-6-chloropurin-9-yl)-2-(benzoyloxymethyl)oxolan-3-yl]methyl benzoate |
| SMILES | CC(=O)O[C@@H]1[C@H](COC(=O)c2ccccc2)[C@@H](COC(=O)c2ccccc2)O[C@H]1n1cnc2c(Cl)nc(N)nc21 |
| InChI | InChI=1S/C27H24ClN5O7/c1-15(34)39-21-18(12-37-25(35)16-8-4-2-5-9-16)19(13-38-26(36)17-10-6-3-7-11-17)40-24(21)33-14-30-20-22(28)31-27(29)32-23(20)33/h2-11,14,18-19,21,24H,12-13H2,1H3,(H2,29,31,32)/t18-,19-,21-,24-/m1/s1 |
| InChIKey | VTRJZDMMZUNJNN-ISQLDUATSA-N |
| XLogP | 3.22 |
| TPSA | 157.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.97 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|