C24H17Cl2FN4O5 — CID 58776118
[(2R,4S,5R)-3-benzoyloxy-5-(2,6-dichloropurin-9-yl)-4-fluorooxolan-2-yl]methyl benzoate (PubChem CID 58776118) has the molecular formula C24H17Cl2FN4O5 and a molecular weight of 531.33 g/mol. Its IUPAC name is [(2R,4S,5R)-3-benzoyloxy-5-(2,6-dichloropurin-9-yl)-4-fluorooxolan-2-yl]methyl benzoate.
| Compound Name | [(2R,4S,5R)-3-benzoyloxy-5-(2,6-dichloropurin-9-yl)-4-fluorooxolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 58776118 |
| Molecular Formula | C24H17Cl2FN4O5 |
| Molecular Weight | 531.33 g/mol |
| Exact Mass | 530.06 |
| IUPAC Name | [(2R,4S,5R)-3-benzoyloxy-5-(2,6-dichloropurin-9-yl)-4-fluorooxolan-2-yl]methyl benzoate |
| SMILES | O=C(OC[C@H]1O[C@@H](n2cnc3c(Cl)nc(Cl)nc32)[C@@H](F)C1OC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H17Cl2FN4O5/c25-19-17-20(30-24(26)29-19)31(12-28-17)21-16(27)18(36-23(33)14-9-5-2-6-10-14)15(35-21)11-34-22(32)13-7-3-1-4-8-13/h1-10,12,15-16,18,21H,11H2/t15-,16+,18?,21-/m1/s1 |
| InChIKey | WDDFXGQXXQAPHG-OTNVPEFLSA-N |
| XLogP | 4.45 |
| TPSA | 105.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.33 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |