C23H20FN3O6 — CID 69098034
[5-(4-amino-2-oxopyrimidin-1-yl)-3-benzoyloxy-4-(18F)fluorooxolan-2-yl]methyl benzoate (PubChem CID 69098034) has the molecular formula C23H20FN3O6 and a molecular weight of 452.43 g/mol. Its IUPAC name is [5-(4-amino-2-oxopyrimidin-1-yl)-3-benzoyloxy-4-(18F)fluorooxolan-2-yl]methyl benzoate.
| Compound Name | [5-(4-amino-2-oxopyrimidin-1-yl)-3-benzoyloxy-4-(18F)fluorooxolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 69098034 |
| Molecular Formula | C23H20FN3O6 |
| Molecular Weight | 452.43 g/mol |
| Exact Mass | 452.14 |
| IUPAC Name | [5-(4-amino-2-oxopyrimidin-1-yl)-3-benzoyloxy-4-(18F)fluorooxolan-2-yl]methyl benzoate |
| SMILES | Nc1ccn(C2OC(COC(=O)c3ccccc3)C(OC(=O)c3ccccc3)C2[18F])c(=O)n1 |
| InChI | InChI=1S/C23H20FN3O6/c24-18-19(33-22(29)15-9-5-2-6-10-15)16(13-31-21(28)14-7-3-1-4-8-14)32-20(18)27-12-11-17(25)26-23(27)30/h1-12,16,18-20H,13H2,(H2,25,26,30)/i24-1 |
| InChIKey | XIUZJSGFBJFTNU-MIGPCILRSA-N |
| XLogP | 2.14 |
| TPSA | 122.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.43 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |