C31H26N2O8 — CID 11376313
[(2R,3R,4R,5R)-3,4-dibenzoyloxy-5-(4-methyl-2-oxopyrimidin-1-yl)oxolan-2-yl]methyl benzoate (PubChem CID 11376313) has the molecular formula C31H26N2O8 and a molecular weight of 554.56 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-3,4-dibenzoyloxy-5-(4-methyl-2-oxopyrimidin-1-yl)oxolan-2-yl]methyl benzoate.
| Compound Name | [(2R,3R,4R,5R)-3,4-dibenzoyloxy-5-(4-methyl-2-oxopyrimidin-1-yl)oxolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 11376313 |
| Molecular Formula | C31H26N2O8 |
| Molecular Weight | 554.56 g/mol |
| Exact Mass | 554.17 |
| IUPAC Name | [(2R,3R,4R,5R)-3,4-dibenzoyloxy-5-(4-methyl-2-oxopyrimidin-1-yl)oxolan-2-yl]methyl benzoate |
| SMILES | Cc1ccn([C@@H]2O[C@H](COC(=O)c3ccccc3)[C@@H](OC(=O)c3ccccc3)[C@H]2OC(=O)c2ccccc2)c(=O)n1 |
| InChI | InChI=1S/C31H26N2O8/c1-20-17-18-33(31(37)32-20)27-26(41-30(36)23-15-9-4-10-16-23)25(40-29(35)22-13-7-3-8-14-22)24(39-27)19-38-28(34)21-11-5-2-6-12-21/h2-18,24-27H,19H2,1H3/t24-,25-,26-,27-/m1/s1 |
| InChIKey | RSRFOERSGOCEMW-FPCALVHFSA-N |
| XLogP | 3.76 |
| TPSA | 123.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.56 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|