C33H30N2O9 — CID 14135541
[(2R,3R,4R,5R)-3,4-dibenzoyloxy-5-(5-ethyl-4-methoxy-2-oxopyrimidin-1-yl)oxolan-2-yl]methyl benzoate (PubChem CID 14135541) has the molecular formula C33H30N2O9 and a molecular weight of 598.61 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-3,4-dibenzoyloxy-5-(5-ethyl-4-methoxy-2-oxopyrimidin-1-yl)oxolan-2-yl]methyl benzoate.
| Compound Name | [(2R,3R,4R,5R)-3,4-dibenzoyloxy-5-(5-ethyl-4-methoxy-2-oxopyrimidin-1-yl)oxolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 14135541 |
| Molecular Formula | C33H30N2O9 |
| Molecular Weight | 598.61 g/mol |
| Exact Mass | 598.20 |
| IUPAC Name | [(2R,3R,4R,5R)-3,4-dibenzoyloxy-5-(5-ethyl-4-methoxy-2-oxopyrimidin-1-yl)oxolan-2-yl]methyl benzoate |
| SMILES | CCc1cn([C@@H]2O[C@H](COC(=O)c3ccccc3)[C@@H](OC(=O)c3ccccc3)[C@H]2OC(=O)c2ccccc2)c(=O)nc1OC |
| InChI | InChI=1S/C33H30N2O9/c1-3-21-19-35(33(39)34-28(21)40-2)29-27(44-32(38)24-17-11-6-12-18-24)26(43-31(37)23-15-9-5-10-16-23)25(42-29)20-41-30(36)22-13-7-4-8-14-22/h4-19,25-27,29H,3,20H2,1-2H3/t25-,26-,27-,29-/m1/s1 |
| InChIKey | MJSOWPIKDCJHEL-LTGLEFCMSA-N |
| XLogP | 4.02 |
| TPSA | 132.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.61 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|